C16H21NO4 — CID 175647610
ethyl 7-(diethylamino)-2-oxo-3,4-dihydrochromene-3-carboxylate (PubChem CID 175647610) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl 7-(diethylamino)-2-oxo-3,4-dihydrochromene-3-carboxylate.
| Compound Name | ethyl 7-(diethylamino)-2-oxo-3,4-dihydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 175647610 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | ethyl 7-(diethylamino)-2-oxo-3,4-dihydrochromene-3-carboxylate |
| SMILES | CCOC(=O)C1Cc2ccc(N(CC)CC)cc2OC1=O |
| InChI | InChI=1S/C16H21NO4/c1-4-17(5-2)12-8-7-11-9-13(15(18)20-6-3)16(19)21-14(11)10-12/h7-8,10,13H,4-6,9H2,1-3H3 |
| InChIKey | AUGXHVDBQLSMND-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|