C18H22O6 — CID 124566665
diethyl (6R,8S)-4-methoxy-7-oxo-5,6,8,9-tetrahydrobenzo[7]annulene-6,8-dicarboxylate (PubChem CID 124566665) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is diethyl (6R,8S)-4-methoxy-7-oxo-5,6,8,9-tetrahydrobenzo[7]annulene-6,8-dicarboxylate.
| Compound Name | diethyl (6R,8S)-4-methoxy-7-oxo-5,6,8,9-tetrahydrobenzo[7]annulene-6,8-dicarboxylate |
|---|---|
| PubChem CID | 124566665 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | diethyl (6R,8S)-4-methoxy-7-oxo-5,6,8,9-tetrahydrobenzo[7]annulene-6,8-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1Cc2cccc(OC)c2C[C@@H](C(=O)OCC)C1=O |
| InChI | InChI=1S/C18H22O6/c1-4-23-17(20)13-9-11-7-6-8-15(22-3)12(11)10-14(16(13)19)18(21)24-5-2/h6-8,13-14H,4-5,9-10H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | NLFFCEGOQWZIQT-UONOGXRCSA-N |
| XLogP | 1.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|