C13H17NO3 — CID 163209041
7-(diethylamino)-4-hydroxy-3,4-dihydrochromen-2-one (PubChem CID 163209041) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 7-(diethylamino)-4-hydroxy-3,4-dihydrochromen-2-one.
| Compound Name | 7-(diethylamino)-4-hydroxy-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 163209041 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 7-(diethylamino)-4-hydroxy-3,4-dihydrochromen-2-one |
| SMILES | CCN(CC)c1ccc2c(c1)OC(=O)CC2O |
| InChI | InChI=1S/C13H17NO3/c1-3-14(4-2)9-5-6-10-11(15)8-13(16)17-12(10)7-9/h5-7,11,15H,3-4,8H2,1-2H3 |
| InChIKey | JIBJWSFLXRPXLX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|