methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate

C11H11BrO3 — CID 115050456

IUPACmethyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate
SMILESCOC(=O)C1Cc2c(Br)cccc2C1O
InChIInChI=1S/C11H11BrO3/c1-15-11(14)8-5-7-6(10(8)13)3-2-4-9(7)12/h2-4,8,10,13H,5H2,1H3
InChIKeyPBUFRUMQYFUFNO-UHFFFAOYSA-N
MW271.11 g/mol
LogP1.83
Rot. Bonds1

About methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate

methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 115050456) has the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. Its IUPAC name is methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate
PubChem CID115050456
Molecular FormulaC11H11BrO3
Molecular Weight271.11 g/mol
Exact Mass269.99
IUPAC Namemethyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate
SMILESCOC(=O)C1Cc2c(Br)cccc2C1O
InChIInChI=1S/C11H11BrO3/c1-15-11(14)8-5-7-6(10(8)13)3-2-4-9(7)12/h2-4,8,10,13H,5H2,1H3
InChIKeyPBUFRUMQYFUFNO-UHFFFAOYSA-N
XLogP1.83
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.11
LogP ≤ 51.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate?
The IUPAC name of methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate (CID 115050456) is methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate.
What is the SMILES notation for methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate?
The canonical SMILES for methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate is COC(=O)C1Cc2c(Br)cccc2C1O.
What is the InChIKey of methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate?
The InChIKey is PBUFRUMQYFUFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO3/c1-15-11(14)8-5-7-6(10(8)13)3-2-4-9(7)12/h2-4,8,10,13H,5H2,1H3.
What are the key properties of methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate?
methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate has a molecular weight of 271.11 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-1-hydroxy-2,3-dihydro-1H-indene-2-carboxylate is sourced from PubChem (CID 115050456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).