About ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate
ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate (PubChem CID 82252135) has the molecular formula C13H15BrO3
and a molecular weight of 299.16 g/mol. Its IUPAC name is ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate.
Analyze ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate?
The IUPAC name of ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate (CID 82252135) is ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate.
What is the SMILES notation for ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate?
The canonical SMILES for ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate is CCOC(=O)C1CCCOc2c(Br)cccc21.
What is the InChIKey of ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate?
The InChIKey is LKNXLXDMGABURQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrO3/c1-2-16-13(15)10-6-4-8-17-12-9(10)5-3-7-11(12)14/h3,5,7,10H,2,4,6,8H2,1H3.
What are the key properties of ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate?
ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate has a molecular weight of 299.16 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylate is sourced from PubChem (CID 82252135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).