C19H32O5 — CID 11809985
ethyl 6,17-dioxo-oxacycloheptadecane-5-carboxylate (PubChem CID 11809985) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is ethyl 6,17-dioxo-oxacycloheptadecane-5-carboxylate.
| Compound Name | ethyl 6,17-dioxo-oxacycloheptadecane-5-carboxylate |
|---|---|
| PubChem CID | 11809985 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | ethyl 6,17-dioxo-oxacycloheptadecane-5-carboxylate |
| SMILES | CCOC(=O)C1CCCOC(=O)CCCCCCCCCCC1=O |
| InChI | InChI=1S/C19H32O5/c1-2-23-19(22)16-12-11-15-24-18(21)14-10-8-6-4-3-5-7-9-13-17(16)20/h16H,2-15H2,1H3 |
| InChIKey | KQKORQHTVILBGI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|