About (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate
(9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate (PubChem CID 159816590) has the molecular formula C37H64O4
and a molecular weight of 572.92 g/mol. Its IUPAC name is (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate.
Molecular Properties
| Compound Name | (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate |
| PubChem CID | 159816590 |
| Molecular Formula | C37H64O4 |
| Molecular Weight | 572.92 g/mol |
| Exact Mass | 572.48 |
| IUPAC Name | (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CCCCCC/C=C\CCCCCCCC1=O.O=C1CCCCCCC/C=C\CCCCCCC1 |
| InChI | InChI=1S/C20H34O3.C17H30O/c1-2-23-20(22)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19(18)21;18-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-17/h3-4,18H,2,5-17H2,1H3;1-2H,3-16H2/b4-3-;2-1- |
| InChIKey | NLRQIKNJCQYHJX-WQMAPKSTSA-N |
| XLogP | 10.96 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.92 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate?
The IUPAC name of (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate (CID 159816590) is (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate.
What is the SMILES notation for (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate?
The canonical SMILES for (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate is CCOC(=O)C1CCCCCC/C=C\CCCCCCCC1=O.O=C1CCCCCCC/C=C\CCCCCCC1.
What is the InChIKey of (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate?
The InChIKey is NLRQIKNJCQYHJX-WQMAPKSTSA-N. The full InChI is InChI=1S/C20H34O3.C17H30O/c1-2-23-20(22)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19(18)21;18-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-17/h3-4,18H,2,5-17H2,1H3;1-2H,3-16H2/b4-3-;2-1-.
What are the key properties of (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate?
(9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate has a molecular weight of 572.92 g/mol, XLogP of 10.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z)-cycloheptadec-9-en-1-one;ethyl (8Z)-17-oxocycloheptadec-8-ene-1-carboxylate is sourced from PubChem (CID 159816590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).