C19H15NO2S — CID 14323096
3-benzyl-1-methylsulfanyl-3H-pyrrolo[1,2-b]isoindole-2,5-dione (PubChem CID 14323096) has the molecular formula C19H15NO2S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-benzyl-1-methylsulfanyl-3H-pyrrolo[1,2-b]isoindole-2,5-dione.
| Compound Name | 3-benzyl-1-methylsulfanyl-3H-pyrrolo[1,2-b]isoindole-2,5-dione |
|---|---|
| PubChem CID | 14323096 |
| Molecular Formula | C19H15NO2S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-benzyl-1-methylsulfanyl-3H-pyrrolo[1,2-b]isoindole-2,5-dione |
| SMILES | CSC1=C2c3ccccc3C(=O)N2C(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H15NO2S/c1-23-18-16-13-9-5-6-10-14(13)19(22)20(16)15(17(18)21)11-12-7-3-2-4-8-12/h2-10,15H,11H2,1H3 |
| InChIKey | WZNIJUOIOJLJHM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |