C18H16N2O4S — CID 101481511
(2S,9bS)-2-benzyl-1-methylsulfonyl-2,9b-dihydroimidazo[1,2-b]isoindole-3,5-dione (PubChem CID 101481511) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is (2S,9bS)-2-benzyl-1-methylsulfonyl-2,9b-dihydroimidazo[1,2-b]isoindole-3,5-dione.
| Compound Name | (2S,9bS)-2-benzyl-1-methylsulfonyl-2,9b-dihydroimidazo[1,2-b]isoindole-3,5-dione |
|---|---|
| PubChem CID | 101481511 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (2S,9bS)-2-benzyl-1-methylsulfonyl-2,9b-dihydroimidazo[1,2-b]isoindole-3,5-dione |
| SMILES | CS(=O)(=O)N1[C@@H](Cc2ccccc2)C(=O)N2C(=O)c3ccccc3[C@@H]21 |
| InChI | InChI=1S/C18H16N2O4S/c1-25(23,24)20-15(11-12-7-3-2-4-8-12)18(22)19-16(20)13-9-5-6-10-14(13)17(19)21/h2-10,15-16H,11H2,1H3/t15-,16-/m0/s1 |
| InChIKey | ZLBJQSVRKXSMAB-HOTGVXAUSA-N |
| XLogP | 1.55 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|