C16H15NO3 — CID 71589841
4-benzyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one (PubChem CID 71589841) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-benzyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one.
| Compound Name | 4-benzyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 71589841 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-benzyl-2,3-dihydroxy-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccccc2C(Cc2ccccc2)C(O)N1O |
| InChI | InChI=1S/C16H15NO3/c18-15-13-9-5-4-8-12(13)14(16(19)17(15)20)10-11-6-2-1-3-7-11/h1-9,14,16,19-20H,10H2 |
| InChIKey | GNVZZPYCUHDBKZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|