About (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one
(2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one (PubChem CID 59883976) has the molecular formula C17H18N2O2
and a molecular weight of 282.34 g/mol. Its IUPAC name is (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one.
Molecular Properties
| Compound Name | (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one |
| PubChem CID | 59883976 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one |
| SMILES | O=C1[C@H](Cc2ccccc2)N[C@@H](Cc2ccccc2)N1O |
| InChI | InChI=1S/C17H18N2O2/c20-17-15(11-13-7-3-1-4-8-13)18-16(19(17)21)12-14-9-5-2-6-10-14/h1-10,15-16,18,21H,11-12H2/t15-,16+/m0/s1 |
| InChIKey | DUXRMYXETCELLQ-JKSUJKDBSA-N |
| XLogP | 1.99 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one?
The IUPAC name of (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one (CID 59883976) is (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one.
What is the SMILES notation for (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one?
The canonical SMILES for (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one is O=C1[C@H](Cc2ccccc2)N[C@@H](Cc2ccccc2)N1O.
What is the InChIKey of (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one?
The InChIKey is DUXRMYXETCELLQ-JKSUJKDBSA-N. The full InChI is InChI=1S/C17H18N2O2/c20-17-15(11-13-7-3-1-4-8-13)18-16(19(17)21)12-14-9-5-2-6-10-14/h1-10,15-16,18,21H,11-12H2/t15-,16+/m0/s1.
What are the key properties of (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one?
(2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one has a molecular weight of 282.34 g/mol, XLogP of 1.99, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2,5-dibenzyl-3-hydroxyimidazolidin-4-one is sourced from PubChem (CID 59883976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).