C21H21NO3 — CID 102286924
2-benzyl-4-(2,2-dimethylpropanoyl)-4H-isoquinoline-1,3-dione (PubChem CID 102286924) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-benzyl-4-(2,2-dimethylpropanoyl)-4H-isoquinoline-1,3-dione.
| Compound Name | 2-benzyl-4-(2,2-dimethylpropanoyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102286924 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-benzyl-4-(2,2-dimethylpropanoyl)-4H-isoquinoline-1,3-dione |
| SMILES | CC(C)(C)C(=O)C1C(=O)N(Cc2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H21NO3/c1-21(2,3)18(23)17-15-11-7-8-12-16(15)19(24)22(20(17)25)13-14-9-5-4-6-10-14/h4-12,17H,13H2,1-3H3 |
| InChIKey | XYDZURFLXJWHIK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|