C14H16N2O4 — CID 67984550
N,N-diethyl-2-hydroxy-1,3-dioxo-4H-isoquinoline-4-carboxamide (PubChem CID 67984550) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is N,N-diethyl-2-hydroxy-1,3-dioxo-4H-isoquinoline-4-carboxamide.
| Compound Name | N,N-diethyl-2-hydroxy-1,3-dioxo-4H-isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 67984550 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N,N-diethyl-2-hydroxy-1,3-dioxo-4H-isoquinoline-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1C(=O)N(O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H16N2O4/c1-3-15(4-2)13(18)11-9-7-5-6-8-10(9)12(17)16(20)14(11)19/h5-8,11,20H,3-4H2,1-2H3 |
| InChIKey | GOLURYKRTMKNAI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|