C25H20N2O3 — CID 122403498
(3S,7aR)-3-benzyl-1-hydroxy-6,7-diphenyl-3,7a-dihydropyrrolo[1,2-a]imidazole-2,5-dione (PubChem CID 122403498) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is (3S,7aR)-3-benzyl-1-hydroxy-6,7-diphenyl-3,7a-dihydropyrrolo[1,2-a]imidazole-2,5-dione.
| Compound Name | (3S,7aR)-3-benzyl-1-hydroxy-6,7-diphenyl-3,7a-dihydropyrrolo[1,2-a]imidazole-2,5-dione |
|---|---|
| PubChem CID | 122403498 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (3S,7aR)-3-benzyl-1-hydroxy-6,7-diphenyl-3,7a-dihydropyrrolo[1,2-a]imidazole-2,5-dione |
| SMILES | O=C1[C@H](Cc2ccccc2)N2C(=O)C(c3ccccc3)=C(c3ccccc3)[C@H]2N1O |
| InChI | InChI=1S/C25H20N2O3/c28-24-20(16-17-10-4-1-5-11-17)26-23(27(24)30)21(18-12-6-2-7-13-18)22(25(26)29)19-14-8-3-9-15-19/h1-15,20,23,30H,16H2/t20-,23+/m0/s1 |
| InChIKey | TVMSPUHVGZWXTO-NZQKXSOJSA-N |
| XLogP | 3.61 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|