C12H17N4O5S+ — CID 90965137
N-hydroxy-4-[(1R,2R)-2-(iminoazaniumylideneamino)cyclohexyl]oxysulfonylbenzeneamine oxide (PubChem CID 90965137) has the molecular formula C12H17N4O5S+ and a molecular weight of 329.36 g/mol. Its IUPAC name is N-hydroxy-4-[(1R,2R)-2-(iminoazaniumylideneamino)cyclohexyl]oxysulfonylbenzeneamine oxide.
| Compound Name | N-hydroxy-4-[(1R,2R)-2-(iminoazaniumylideneamino)cyclohexyl]oxysulfonylbenzeneamine oxide |
|---|---|
| PubChem CID | 90965137 |
| Molecular Formula | C12H17N4O5S+ |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-hydroxy-4-[(1R,2R)-2-(iminoazaniumylideneamino)cyclohexyl]oxysulfonylbenzeneamine oxide |
| SMILES | N=[N+]=N[C@@H]1CCCC[C@H]1OS(=O)(=O)c1ccc([NH+]([O-])O)cc1 |
| InChI | InChI=1S/C12H17N4O5S/c13-15-14-11-3-1-2-4-12(11)21-22(19,20)10-7-5-9(6-8-10)16(17)18/h5-8,11-13,16-17H,1-4H2/q+1/t11-,12-/m1/s1 |
| InChIKey | ZZYZPNVHVZBAKC-VXGBXAGGSA-N |
| XLogP | 0.66 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|