C12H16N4O5S — CID 58607060
4-[(1R,2R)-2-azidocyclohexyl]oxysulfonyl-N-hydroxybenzeneamine oxide (PubChem CID 58607060) has the molecular formula C12H16N4O5S and a molecular weight of 328.35 g/mol. Its IUPAC name is 4-[(1R,2R)-2-azidocyclohexyl]oxysulfonyl-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[(1R,2R)-2-azidocyclohexyl]oxysulfonyl-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 58607060 |
| Molecular Formula | C12H16N4O5S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 4-[(1R,2R)-2-azidocyclohexyl]oxysulfonyl-N-hydroxybenzeneamine oxide |
| SMILES | [N-]=[N+]=N[C@@H]1CCCC[C@H]1OS(=O)(=O)c1ccc([NH+]([O-])O)cc1 |
| InChI | InChI=1S/C12H16N4O5S/c13-15-14-11-3-1-2-4-12(11)21-22(19,20)10-7-5-9(6-8-10)16(17)18/h5-8,11-12,16-17H,1-4H2/t11-,12-/m1/s1 |
| InChIKey | AETSXEIJCRYYIZ-VXGBXAGGSA-N |
| XLogP | 1.42 |
| TPSA | 139.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|