C18H20O4S4 — CID 144629943
[5-(4-methylphenyl)sulfanyloxydithian-4-yl] 4-methylbenzenesulfonate (PubChem CID 144629943) has the molecular formula C18H20O4S4 and a molecular weight of 428.62 g/mol. Its IUPAC name is [5-(4-methylphenyl)sulfanyloxydithian-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [5-(4-methylphenyl)sulfanyloxydithian-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 144629943 |
| Molecular Formula | C18H20O4S4 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | [5-(4-methylphenyl)sulfanyloxydithian-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(SOC2CSSCC2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H20O4S4/c1-13-3-7-15(8-4-13)25-21-17-11-23-24-12-18(17)22-26(19,20)16-9-5-14(2)6-10-16/h3-10,17-18H,11-12H2,1-2H3 |
| InChIKey | MNSXCSWFHFBPMU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|