C13H15F3N2O4S — CID 141035784
2-[4-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 141035784) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 2-[4-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 141035784 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-[4-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | NC(=O)C1CCNC(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C13H15F3N2O4S/c14-13(15,16)22-9-1-3-10(4-2-9)23(20,21)11-7-8(12(17)19)5-6-18-11/h1-4,8,11,18H,5-7H2,(H2,17,19) |
| InChIKey | DCHBGIDNERIVSG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |