C22H30F3NO7S — CID 86662709
ditert-butyl (2S,5S)-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidine-1,2-dicarboxylate (PubChem CID 86662709) has the molecular formula C22H30F3NO7S and a molecular weight of 509.54 g/mol. Its IUPAC name is ditert-butyl (2S,5S)-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,5S)-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 86662709 |
| Molecular Formula | C22H30F3NO7S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | ditert-butyl (2S,5S)-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CC[C@H](OS(=O)(=O)c2ccc(C(F)(F)F)cc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30F3NO7S/c1-20(2,3)31-18(27)17-12-9-15(13-26(17)19(28)32-21(4,5)6)33-34(29,30)16-10-7-14(8-11-16)22(23,24)25/h7-8,10-11,15,17H,9,12-13H2,1-6H3/t15-,17-/m0/s1 |
| InChIKey | GOMRDVTXMYSCAF-RDJZCZTQSA-N |
| XLogP | 4.52 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|