C17H22N2O5S — CID 175981919
tert-butyl (2R,4S)-2-cyano-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate (PubChem CID 175981919) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is tert-butyl (2R,4S)-2-cyano-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-2-cyano-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175981919 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | tert-butyl (2R,4S)-2-cyano-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C[C@H](C#N)N(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C17H22N2O5S/c1-12-5-7-15(8-6-12)25(21,22)24-14-9-13(10-18)19(11-14)16(20)23-17(2,3)4/h5-8,13-14H,9,11H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | GJCTZHRLNACJHT-KGLIPLIRSA-N |
| XLogP | 2.60 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|