C37H31F2N3O3 — CID 164588658
methyl (2S)-3-[4-(5,7-difluoro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]-2-(tritylamino)propanoate (PubChem CID 164588658) has the molecular formula C37H31F2N3O3 and a molecular weight of 603.67 g/mol. Its IUPAC name is methyl (2S)-3-[4-(5,7-difluoro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-[4-(5,7-difluoro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 164588658 |
| Molecular Formula | C37H31F2N3O3 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | methyl (2S)-3-[4-(5,7-difluoro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]-2-(tritylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(-n2c(=O)n(C)c3cc(F)cc(F)c32)cc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H31F2N3O3/c1-41-33-24-29(38)23-31(39)34(33)42(36(41)44)30-20-18-25(19-21-30)22-32(35(43)45-2)40-37(26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-21,23-24,32,40H,22H2,1-2H3/t32-/m0/s1 |
| InChIKey | SKLYBDUKAFZDTF-YTTGMZPUSA-N |
| XLogP | 6.27 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|