C39H38N4O3 — CID 164588530
methyl (2S)-3-[4-[6-(dimethylamino)-3-methyl-2-oxobenzimidazol-1-yl]phenyl]-2-(tritylamino)propanoate (PubChem CID 164588530) has the molecular formula C39H38N4O3 and a molecular weight of 610.76 g/mol. Its IUPAC name is methyl (2S)-3-[4-[6-(dimethylamino)-3-methyl-2-oxobenzimidazol-1-yl]phenyl]-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-[4-[6-(dimethylamino)-3-methyl-2-oxobenzimidazol-1-yl]phenyl]-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 164588530 |
| Molecular Formula | C39H38N4O3 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | methyl (2S)-3-[4-[6-(dimethylamino)-3-methyl-2-oxobenzimidazol-1-yl]phenyl]-2-(tritylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(-n2c(=O)n(C)c3ccc(N(C)C)cc32)cc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H38N4O3/c1-41(2)33-24-25-35-36(27-33)43(38(45)42(35)3)32-22-20-28(21-23-32)26-34(37(44)46-4)40-39(29-14-8-5-9-15-29,30-16-10-6-11-17-30)31-18-12-7-13-19-31/h5-25,27,34,40H,26H2,1-4H3/t34-/m0/s1 |
| InChIKey | CWCDSZGMDAXGHN-UMSFTDKQSA-N |
| XLogP | 6.06 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|