About methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate
methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate (PubChem CID 164588614) has the molecular formula C18H17Cl2N3O3
and a molecular weight of 394.26 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate |
| PubChem CID | 164588614 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(-n2c(=O)n(C)c3cc(Cl)c(Cl)cc32)cc1 |
| InChI | InChI=1S/C18H17Cl2N3O3/c1-22-15-8-12(19)13(20)9-16(15)23(18(22)25)11-5-3-10(4-6-11)7-14(21)17(24)26-2/h3-6,8-9,14H,7,21H2,1-2H3/t14-/m0/s1 |
| InChIKey | ZDWWXCZHQMHBFC-AWEZNQCLSA-N |
| XLogP | 2.68 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate?
The IUPAC name of methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate (CID 164588614) is methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate.
What is the SMILES notation for methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate?
The canonical SMILES for methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate is COC(=O)[C@@H](N)Cc1ccc(-n2c(=O)n(C)c3cc(Cl)c(Cl)cc32)cc1.
What is the InChIKey of methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate?
The InChIKey is ZDWWXCZHQMHBFC-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H17Cl2N3O3/c1-22-15-8-12(19)13(20)9-16(15)23(18(22)25)11-5-3-10(4-6-11)7-14(21)17(24)26-2/h3-6,8-9,14H,7,21H2,1-2H3/t14-/m0/s1.
What are the key properties of methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate?
methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate has a molecular weight of 394.26 g/mol, XLogP of 2.68, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-amino-3-[4-(5,6-dichloro-3-methyl-2-oxobenzimidazol-1-yl)phenyl]propanoate is sourced from PubChem (CID 164588614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).