C18H18ClN3O2S — CID 174152817
methyl 2-amino-3-[4-(7-chloro-3-methyl-2-sulfanylidenebenzimidazol-1-yl)phenyl]propanoate (PubChem CID 174152817) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is methyl 2-amino-3-[4-(7-chloro-3-methyl-2-sulfanylidenebenzimidazol-1-yl)phenyl]propanoate.
| Compound Name | methyl 2-amino-3-[4-(7-chloro-3-methyl-2-sulfanylidenebenzimidazol-1-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 174152817 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | methyl 2-amino-3-[4-(7-chloro-3-methyl-2-sulfanylidenebenzimidazol-1-yl)phenyl]propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(-n2c(=S)n(C)c3cccc(Cl)c32)cc1 |
| InChI | InChI=1S/C18H18ClN3O2S/c1-21-15-5-3-4-13(19)16(15)22(18(21)25)12-8-6-11(7-9-12)10-14(20)17(23)24-2/h3-9,14H,10,20H2,1-2H3 |
| InChIKey | OYJYRIHXRAPISV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|