C30H38N4O6S — CID 174403687
benzyl (2S)-3-[4-(4-azidobutoxy)phenyl]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoate (PubChem CID 174403687) has the molecular formula C30H38N4O6S and a molecular weight of 582.72 g/mol. Its IUPAC name is benzyl (2S)-3-[4-(4-azidobutoxy)phenyl]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoate.
| Compound Name | benzyl (2S)-3-[4-(4-azidobutoxy)phenyl]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoate |
|---|---|
| PubChem CID | 174403687 |
| Molecular Formula | C30H38N4O6S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | benzyl (2S)-3-[4-(4-azidobutoxy)phenyl]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]propanoate |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)N[C@@H](Cc1ccc(OCCCCN=[N+]=[N-])cc1)C(=O)OCc1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C30H38N4O6S/c1-29(2)24-14-15-30(29,27(35)19-24)21-41(37,38)33-26(28(36)40-20-23-8-4-3-5-9-23)18-22-10-12-25(13-11-22)39-17-7-6-16-32-34-31/h3-5,8-13,24,26,33H,6-7,14-21H2,1-2H3/t24?,26-,30?/m0/s1 |
| InChIKey | QBVLDAFZLFDCJC-OUZZWEIQSA-N |
| XLogP | 5.13 |
| TPSA | 147.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|