C17H29N2O3Si — CID 174983568
CID 174983568 (PubChem CID 174983568) has the molecular formula C17H29N2O3Si and a molecular weight of 337.52 g/mol.
| Compound Name | CID 174983568 |
|---|---|
| PubChem CID | 174983568 |
| Molecular Formula | C17H29N2O3Si |
| Molecular Weight | 337.52 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | — |
| SMILES | C=CC(N)=O.C[Si](C)N(CCc1ccc(O)c(O)c1)C(C)(C)C |
| InChI | InChI=1S/C14H24NO2Si.C3H5NO/c1-14(2,3)15(18(4)5)9-8-11-6-7-12(16)13(17)10-11;1-2-3(4)5/h6-7,10,16-17H,8-9H2,1-5H3;2H,1H2,(H2,4,5) |
| InChIKey | JJSPWYAPABEPNC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|