About CID 174983568
CID 174983568 (PubChem CID 174983568) has the molecular formula C17H29N2O3Si
and a molecular weight of 337.52 g/mol.
Molecular Properties
| Compound Name | CID 174983568 |
| PubChem CID | 174983568 |
| Molecular Formula | C17H29N2O3Si |
| Molecular Weight | 337.52 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | — |
| SMILES | C=CC(N)=O.C[Si](C)N(CCc1ccc(O)c(O)c1)C(C)(C)C |
| InChI | InChI=1S/C14H24NO2Si.C3H5NO/c1-14(2,3)15(18(4)5)9-8-11-6-7-12(16)13(17)10-11;1-2-3(4)5/h6-7,10,16-17H,8-9H2,1-5H3;2H,1H2,(H2,4,5) |
| InChIKey | JJSPWYAPABEPNC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 174983568 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174983568?
The IUPAC name of CID 174983568 (CID 174983568) is not available.
What is the SMILES notation for CID 174983568?
The canonical SMILES for CID 174983568 is C=CC(N)=O.C[Si](C)N(CCc1ccc(O)c(O)c1)C(C)(C)C.
What is the InChIKey of CID 174983568?
The InChIKey is JJSPWYAPABEPNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24NO2Si.C3H5NO/c1-14(2,3)15(18(4)5)9-8-11-6-7-12(16)13(17)10-11;1-2-3(4)5/h6-7,10,16-17H,8-9H2,1-5H3;2H,1H2,(H2,4,5).
What are the key properties of CID 174983568?
CID 174983568 has a molecular weight of 337.52 g/mol, XLogP of 2.65, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174983568 is sourced from PubChem (CID 174983568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).