C13H18N2O3 — CID 175227935
prop-2-enamide;4-[(prop-2-enylamino)methyl]benzene-1,2-diol (PubChem CID 175227935) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is prop-2-enamide;4-[(prop-2-enylamino)methyl]benzene-1,2-diol.
| Compound Name | prop-2-enamide;4-[(prop-2-enylamino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 175227935 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | prop-2-enamide;4-[(prop-2-enylamino)methyl]benzene-1,2-diol |
| SMILES | C=CC(N)=O.C=CCNCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H13NO2.C3H5NO/c1-2-5-11-7-8-3-4-9(12)10(13)6-8;1-2-3(4)5/h2-4,6,11-13H,1,5,7H2;2H,1H2,(H2,4,5) |
| InChIKey | FFKPBLCOMAIZGV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|