C18H20N2O — CID 70312424
4-methyl-3-[4-[(prop-2-enylamino)methyl]phenyl]benzamide (PubChem CID 70312424) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-methyl-3-[4-[(prop-2-enylamino)methyl]phenyl]benzamide.
| Compound Name | 4-methyl-3-[4-[(prop-2-enylamino)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 70312424 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 4-methyl-3-[4-[(prop-2-enylamino)methyl]phenyl]benzamide |
| SMILES | C=CCNCc1ccc(-c2cc(C(N)=O)ccc2C)cc1 |
| InChI | InChI=1S/C18H20N2O/c1-3-10-20-12-14-5-8-15(9-6-14)17-11-16(18(19)21)7-4-13(17)2/h3-9,11,20H,1,10,12H2,2H3,(H2,19,21) |
| InChIKey | LAEWEVLTVNTUGD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|