C22H28N2O — CID 143518292
ethenyl 3-[4-(butylaminomethyl)phenyl]-N,4-dimethylbenzenecarboximidate (PubChem CID 143518292) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is ethenyl 3-[4-(butylaminomethyl)phenyl]-N,4-dimethylbenzenecarboximidate.
| Compound Name | ethenyl 3-[4-(butylaminomethyl)phenyl]-N,4-dimethylbenzenecarboximidate |
|---|---|
| PubChem CID | 143518292 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | ethenyl 3-[4-(butylaminomethyl)phenyl]-N,4-dimethylbenzenecarboximidate |
| SMILES | C=CO/C(=N\C)c1ccc(C)c(-c2ccc(CNCCCC)cc2)c1 |
| InChI | InChI=1S/C22H28N2O/c1-5-7-14-24-16-18-9-12-19(13-10-18)21-15-20(11-8-17(21)3)22(23-4)25-6-2/h6,8-13,15,24H,2,5,7,14,16H2,1,3-4H3/b23-22- |
| InChIKey | DJNSECXGVXYZPD-FCQUAONHSA-N |
| XLogP | 5.09 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|