C23H30N2O — CID 59316454
3-[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]-4-methylbenzamide (PubChem CID 59316454) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 3-[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]-4-methylbenzamide.
| Compound Name | 3-[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 59316454 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 3-[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)cc1-c1ccc(CNC2CCC(C)(C)CC2)cc1 |
| InChI | InChI=1S/C23H30N2O/c1-16-4-7-19(22(24)26)14-21(16)18-8-5-17(6-9-18)15-25-20-10-12-23(2,3)13-11-20/h4-9,14,20,25H,10-13,15H2,1-3H3,(H2,24,26) |
| InChIKey | BQJFWVHRAYVSDC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |