About 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide
4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide (PubChem CID 67161069) has the molecular formula C20H26N2OS
and a molecular weight of 342.51 g/mol. Its IUPAC name is 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide.
Molecular Properties
| Compound Name | 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide |
| PubChem CID | 67161069 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide |
| SMILES | CC1(C)CCC(NCc2cc(-c3ccc(C(N)=O)cc3)cs2)CC1 |
| InChI | InChI=1S/C20H26N2OS/c1-20(2)9-7-17(8-10-20)22-12-18-11-16(13-24-18)14-3-5-15(6-4-14)19(21)23/h3-6,11,13,17,22H,7-10,12H2,1-2H3,(H2,21,23) |
| InChIKey | AGLLUKDGBDSZRH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide?
The IUPAC name of 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide (CID 67161069) is 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide.
What is the SMILES notation for 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide?
The canonical SMILES for 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide is CC1(C)CCC(NCc2cc(-c3ccc(C(N)=O)cc3)cs2)CC1.
What is the InChIKey of 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide?
The InChIKey is AGLLUKDGBDSZRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2OS/c1-20(2)9-7-17(8-10-20)22-12-18-11-16(13-24-18)14-3-5-15(6-4-14)19(21)23/h3-6,11,13,17,22H,7-10,12H2,1-2H3,(H2,21,23).
What are the key properties of 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide?
4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide has a molecular weight of 342.51 g/mol, XLogP of 4.57, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide is sourced from PubChem (CID 67161069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).