C20H26N2OS — CID 67161069
4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide (PubChem CID 67161069) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide.
| Compound Name | 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide |
|---|---|
| PubChem CID | 67161069 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-[5-[[(4,4-dimethylcyclohexyl)amino]methyl]thiophen-3-yl]benzamide |
| SMILES | CC1(C)CCC(NCc2cc(-c3ccc(C(N)=O)cc3)cs2)CC1 |
| InChI | InChI=1S/C20H26N2OS/c1-20(2)9-7-17(8-10-20)22-12-18-11-16(13-24-18)14-3-5-15(6-4-14)19(21)23/h3-6,11,13,17,22H,7-10,12H2,1-2H3,(H2,21,23) |
| InChIKey | AGLLUKDGBDSZRH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |