About 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride
4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride (PubChem CID 68604148) has the molecular formula C22H28Cl2N2O
and a molecular weight of 407.39 g/mol. Its IUPAC name is 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride.
Molecular Properties
| Compound Name | 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride |
| PubChem CID | 68604148 |
| Molecular Formula | C22H28Cl2N2O |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride |
| SMILES | CC1(C)CCC(NCc2cc(Cl)cc(-c3ccc(C(N)=O)cc3)c2)CC1.Cl |
| InChI | InChI=1S/C22H27ClN2O.ClH/c1-22(2)9-7-20(8-10-22)25-14-15-11-18(13-19(23)12-15)16-3-5-17(6-4-16)21(24)26;/h3-6,11-13,20,25H,7-10,14H2,1-2H3,(H2,24,26);1H |
| InChIKey | ZSTOGWZNHYHPQO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride?
The IUPAC name of 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride (CID 68604148) is 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride.
What is the SMILES notation for 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride?
The canonical SMILES for 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride is CC1(C)CCC(NCc2cc(Cl)cc(-c3ccc(C(N)=O)cc3)c2)CC1.Cl.
What is the InChIKey of 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride?
The InChIKey is ZSTOGWZNHYHPQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27ClN2O.ClH/c1-22(2)9-7-20(8-10-22)25-14-15-11-18(13-19(23)12-15)16-3-5-17(6-4-16)21(24)26;/h3-6,11-13,20,25H,7-10,14H2,1-2H3,(H2,24,26);1H.
What are the key properties of 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride?
4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride has a molecular weight of 407.39 g/mol, XLogP of 5.59, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-chloro-5-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]benzamide;hydrochloride is sourced from PubChem (CID 68604148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).