About 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide
4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide (PubChem CID 58276377) has the molecular formula C23H21ClN2O
and a molecular weight of 376.89 g/mol. Its IUPAC name is 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide.
Molecular Properties
| Compound Name | 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide |
| PubChem CID | 58276377 |
| Molecular Formula | C23H21ClN2O |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cc(Cl)cc(CNC3Cc4ccccc4C3)c2)cc1 |
| InChI | InChI=1S/C23H21ClN2O/c24-21-10-15(14-26-22-12-18-3-1-2-4-19(18)13-22)9-20(11-21)16-5-7-17(8-6-16)23(25)27/h1-11,22,26H,12-14H2,(H2,25,27) |
| InChIKey | IJLKDDZKBVAKGV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide?
The IUPAC name of 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide (CID 58276377) is 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide.
What is the SMILES notation for 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide?
The canonical SMILES for 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide is NC(=O)c1ccc(-c2cc(Cl)cc(CNC3Cc4ccccc4C3)c2)cc1.
What is the InChIKey of 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide?
The InChIKey is IJLKDDZKBVAKGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21ClN2O/c24-21-10-15(14-26-22-12-18-3-1-2-4-19(18)13-22)9-20(11-21)16-5-7-17(8-6-16)23(25)27/h1-11,22,26H,12-14H2,(H2,25,27).
What are the key properties of 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide?
4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide has a molecular weight of 376.89 g/mol, XLogP of 4.36, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide is sourced from PubChem (CID 58276377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).