C23H21ClN2O — CID 58276377
4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide (PubChem CID 58276377) has the molecular formula C23H21ClN2O and a molecular weight of 376.89 g/mol. Its IUPAC name is 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide.
| Compound Name | 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 58276377 |
| Molecular Formula | C23H21ClN2O |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 4-[3-chloro-5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cc(Cl)cc(CNC3Cc4ccccc4C3)c2)cc1 |
| InChI | InChI=1S/C23H21ClN2O/c24-21-10-15(14-26-22-12-18-3-1-2-4-19(18)13-22)9-20(11-21)16-5-7-17(8-6-16)23(25)27/h1-11,22,26H,12-14H2,(H2,25,27) |
| InChIKey | IJLKDDZKBVAKGV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |