C15H20F3N3O — CID 119107058
4-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]benzamide (PubChem CID 119107058) has the molecular formula C15H20F3N3O and a molecular weight of 315.34 g/mol. Its IUPAC name is 4-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]benzamide.
| Compound Name | 4-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 119107058 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CNC2CCN(CC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C15H20F3N3O/c16-15(17,18)10-21-7-5-13(6-8-21)20-9-11-1-3-12(4-2-11)14(19)22/h1-4,13,20H,5-10H2,(H2,19,22) |
| InChIKey | RYJSVQHYTOOJHN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |