C20H22Cl2N2O2 — CID 122031321
4-[[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]methyl]benzoic acid (PubChem CID 122031321) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is 4-[[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031321 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-[[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC2CCN(Cc3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c21-18-6-3-15(11-19(18)22)13-24-9-7-17(8-10-24)23-12-14-1-4-16(5-2-14)20(25)26/h1-6,11,17,23H,7-10,12-13H2,(H,25,26) |
| InChIKey | YEQIKEHJWDUOON-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |