C14H18ClNO2 — CID 20541926
6-[2-(dimethylamino)ethyl]naphthalene-2,3-diol;hydrochloride (PubChem CID 20541926) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethyl]naphthalene-2,3-diol;hydrochloride.
| Compound Name | 6-[2-(dimethylamino)ethyl]naphthalene-2,3-diol;hydrochloride |
|---|---|
| PubChem CID | 20541926 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-[2-(dimethylamino)ethyl]naphthalene-2,3-diol;hydrochloride |
| SMILES | CN(C)CCc1ccc2cc(O)c(O)cc2c1.Cl |
| InChI | InChI=1S/C14H17NO2.ClH/c1-15(2)6-5-10-3-4-11-8-13(16)14(17)9-12(11)7-10;/h3-4,7-9,16-17H,5-6H2,1-2H3;1H |
| InChIKey | SUTQCEOKWRJLTB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|