C10H14ClF2N — CID 50988115
4-(3,4-difluorophenyl)butan-2-amine;hydrochloride (PubChem CID 50988115) has the molecular formula C10H14ClF2N and a molecular weight of 221.68 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)butan-2-amine;hydrochloride.
| Compound Name | 4-(3,4-difluorophenyl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 50988115 |
| Molecular Formula | C10H14ClF2N |
| Molecular Weight | 221.68 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 4-(3,4-difluorophenyl)butan-2-amine;hydrochloride |
| SMILES | CC(N)CCc1ccc(F)c(F)c1.Cl |
| InChI | InChI=1S/C10H13F2N.ClH/c1-7(13)2-3-8-4-5-9(11)10(12)6-8;/h4-7H,2-3,13H2,1H3;1H |
| InChIKey | LBAGZASJLNIHPI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |