C21H27NO5S — CID 70244746
2-[3-[[2-(4-tert-butylphenyl)ethylsulfonylamino]methyl]phenoxy]acetic acid (PubChem CID 70244746) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-[3-[[2-(4-tert-butylphenyl)ethylsulfonylamino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[2-(4-tert-butylphenyl)ethylsulfonylamino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 70244746 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[3-[[2-(4-tert-butylphenyl)ethylsulfonylamino]methyl]phenoxy]acetic acid |
| SMILES | CC(C)(C)c1ccc(CCS(=O)(=O)NCc2cccc(OCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-21(2,3)18-9-7-16(8-10-18)11-12-28(25,26)22-14-17-5-4-6-19(13-17)27-15-20(23)24/h4-10,13,22H,11-12,14-15H2,1-3H3,(H,23,24) |
| InChIKey | ZVEZJNHYTXCKLN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |