C19H22O6 — CID 156719095
2-[3-[3-(2-hydroxy-4,5-dimethoxyphenyl)propyl]phenoxy]acetic acid (PubChem CID 156719095) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[3-[3-(2-hydroxy-4,5-dimethoxyphenyl)propyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[3-(2-hydroxy-4,5-dimethoxyphenyl)propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 156719095 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[3-[3-(2-hydroxy-4,5-dimethoxyphenyl)propyl]phenoxy]acetic acid |
| SMILES | COc1cc(O)c(CCCc2cccc(OCC(=O)O)c2)cc1OC |
| InChI | InChI=1S/C19H22O6/c1-23-17-10-14(16(20)11-18(17)24-2)7-3-5-13-6-4-8-15(9-13)25-12-19(21)22/h4,6,8-11,20H,3,5,7,12H2,1-2H3,(H,21,22) |
| InChIKey | UDHXLBZKAXEDMW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |