C20H35NO4S2 — CID 59545381
3-[4-(7-tert-butylsulfonylheptyl)anilino]propane-1-sulfinic acid (PubChem CID 59545381) has the molecular formula C20H35NO4S2 and a molecular weight of 417.64 g/mol. Its IUPAC name is 3-[4-(7-tert-butylsulfonylheptyl)anilino]propane-1-sulfinic acid.
| Compound Name | 3-[4-(7-tert-butylsulfonylheptyl)anilino]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 59545381 |
| Molecular Formula | C20H35NO4S2 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 3-[4-(7-tert-butylsulfonylheptyl)anilino]propane-1-sulfinic acid |
| SMILES | CC(C)(C)S(=O)(=O)CCCCCCCc1ccc(NCCCS(=O)O)cc1 |
| InChI | InChI=1S/C20H35NO4S2/c1-20(2,3)27(24,25)17-8-6-4-5-7-10-18-11-13-19(14-12-18)21-15-9-16-26(22)23/h11-14,21H,4-10,15-17H2,1-3H3,(H,22,23) |
| InChIKey | QYBZVRBWBOUIOF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|