C27H48ClNO6S — CID 172865516
(2R)-N-(3-tert-butylsulfonylpropyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-methyloctanamide;hydrochloride (PubChem CID 172865516) has the molecular formula C27H48ClNO6S and a molecular weight of 550.20 g/mol. Its IUPAC name is (2R)-N-(3-tert-butylsulfonylpropyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-methyloctanamide;hydrochloride.
| Compound Name | (2R)-N-(3-tert-butylsulfonylpropyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-methyloctanamide;hydrochloride |
|---|---|
| PubChem CID | 172865516 |
| Molecular Formula | C27H48ClNO6S |
| Molecular Weight | 550.20 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | (2R)-N-(3-tert-butylsulfonylpropyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-methyloctanamide;hydrochloride |
| SMILES | COCCCOc1cc(CCCCCC[C@@H](C)C(=O)NCCCS(=O)(=O)C(C)(C)C)ccc1OC.Cl |
| InChI | InChI=1S/C27H47NO6S.ClH/c1-22(26(29)28-17-11-20-35(30,31)27(2,3)4)13-9-7-8-10-14-23-15-16-24(33-6)25(21-23)34-19-12-18-32-5;/h15-16,21-22H,7-14,17-20H2,1-6H3,(H,28,29);1H/t22-;/m1./s1 |
| InChIKey | ZXXNLWPJYUQUKR-VZYDHVRKSA-N |
| XLogP | 5.38 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.20 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|