C31H54N2O5 — CID 91519200
N-[4-(dimethylamino)-4-oxobutyl]-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,2-di(propan-2-yl)octanamide (PubChem CID 91519200) has the molecular formula C31H54N2O5 and a molecular weight of 534.78 g/mol. Its IUPAC name is N-[4-(dimethylamino)-4-oxobutyl]-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,2-di(propan-2-yl)octanamide.
| Compound Name | N-[4-(dimethylamino)-4-oxobutyl]-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,2-di(propan-2-yl)octanamide |
|---|---|
| PubChem CID | 91519200 |
| Molecular Formula | C31H54N2O5 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.40 |
| IUPAC Name | N-[4-(dimethylamino)-4-oxobutyl]-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,2-di(propan-2-yl)octanamide |
| SMILES | COCCCOc1cc(CCCCCCC(C(=O)NCCCC(=O)N(C)C)(C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C31H54N2O5/c1-24(2)31(25(3)4,30(35)32-20-13-16-29(34)33(5)6)19-12-10-9-11-15-26-17-18-27(37-8)28(23-26)38-22-14-21-36-7/h17-18,23-25H,9-16,19-22H2,1-8H3,(H,32,35) |
| InChIKey | YEZHJYUZUAMTJA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|