C30H52N2O5 — CID 91195500
N-(2-formamido-2-methylpropyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,2-di(propan-2-yl)octanamide (PubChem CID 91195500) has the molecular formula C30H52N2O5 and a molecular weight of 520.76 g/mol. Its IUPAC name is N-(2-formamido-2-methylpropyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,2-di(propan-2-yl)octanamide.
| Compound Name | N-(2-formamido-2-methylpropyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,2-di(propan-2-yl)octanamide |
|---|---|
| PubChem CID | 91195500 |
| Molecular Formula | C30H52N2O5 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | N-(2-formamido-2-methylpropyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,2-di(propan-2-yl)octanamide |
| SMILES | COCCCOc1cc(CCCCCCC(C(=O)NCC(C)(C)NC=O)(C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C30H52N2O5/c1-23(2)30(24(3)4,28(34)31-21-29(5,6)32-22-33)17-12-10-9-11-14-25-15-16-26(36-8)27(20-25)37-19-13-18-35-7/h15-16,20,22-24H,9-14,17-19,21H2,1-8H3,(H,31,34)(H,32,33) |
| InChIKey | IFMSFMPBSKIDML-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|