C24H40N2O5 — CID 154511678
(2R)-N-(2-acetamidoethyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-methyloctanamide (PubChem CID 154511678) has the molecular formula C24H40N2O5 and a molecular weight of 436.59 g/mol. Its IUPAC name is (2R)-N-(2-acetamidoethyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-methyloctanamide.
| Compound Name | (2R)-N-(2-acetamidoethyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-methyloctanamide |
|---|---|
| PubChem CID | 154511678 |
| Molecular Formula | C24H40N2O5 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | (2R)-N-(2-acetamidoethyl)-8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-methyloctanamide |
| SMILES | COCCCOc1cc(CCCCCC[C@@H](C)C(=O)NCCNC(C)=O)ccc1OC |
| InChI | InChI=1S/C24H40N2O5/c1-19(24(28)26-15-14-25-20(2)27)10-7-5-6-8-11-21-12-13-22(30-4)23(18-21)31-17-9-16-29-3/h12-13,18-19H,5-11,14-17H2,1-4H3,(H,25,27)(H,26,28)/t19-/m1/s1 |
| InChIKey | GVIXPMCSXHVBRV-LJQANCHMSA-N |
| XLogP | 3.49 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|