C32H56N2O4 — CID 91594365
N-(3-amino-2,2-dimethyl-3-oxopropyl)-8-[3-(3-methoxypropoxy)-4-propan-2-ylphenyl]-2,2-di(propan-2-yl)octanamide (PubChem CID 91594365) has the molecular formula C32H56N2O4 and a molecular weight of 532.81 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethyl-3-oxopropyl)-8-[3-(3-methoxypropoxy)-4-propan-2-ylphenyl]-2,2-di(propan-2-yl)octanamide.
| Compound Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-8-[3-(3-methoxypropoxy)-4-propan-2-ylphenyl]-2,2-di(propan-2-yl)octanamide |
|---|---|
| PubChem CID | 91594365 |
| Molecular Formula | C32H56N2O4 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.42 |
| IUPAC Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-8-[3-(3-methoxypropoxy)-4-propan-2-ylphenyl]-2,2-di(propan-2-yl)octanamide |
| SMILES | COCCCOc1cc(CCCCCCC(C(=O)NCC(C)(C)C(N)=O)(C(C)C)C(C)C)ccc1C(C)C |
| InChI | InChI=1S/C32H56N2O4/c1-23(2)27-17-16-26(21-28(27)38-20-14-19-37-9)15-12-10-11-13-18-32(24(3)4,25(5)6)30(36)34-22-31(7,8)29(33)35/h16-17,21,23-25H,10-15,18-20,22H2,1-9H3,(H2,33,35)(H,34,36) |
| InChIKey | QUWXCUYPOLJOTK-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|