C68H78O11 — CID 21363155
[5-[4-(3-methoxy-4-methylphenyl)phenyl]-2-nonoxyphenyl] 5-[4-[3-acetyl-4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]-2-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 21363155) has the molecular formula C68H78O11 and a molecular weight of 1071.36 g/mol. Its IUPAC name is [5-[4-(3-methoxy-4-methylphenyl)phenyl]-2-nonoxyphenyl] 5-[4-[3-acetyl-4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]-2-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [5-[4-(3-methoxy-4-methylphenyl)phenyl]-2-nonoxyphenyl] 5-[4-[3-acetyl-4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]-2-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 21363155 |
| Molecular Formula | C68H78O11 |
| Molecular Weight | 1071.36 g/mol |
| Exact Mass | 1070.55 |
| IUPAC Name | [5-[4-(3-methoxy-4-methylphenyl)phenyl]-2-nonoxyphenyl] 5-[4-[3-acetyl-4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]-2-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(-c3ccc(OCCCCCCOC(=O)C=C)c(C(=O)Oc4cc(-c5ccc(-c6ccc(C)c(OC)c6)cc5)ccc4OCCCCCCCCC)c3)cc2)cc1C(C)=O |
| InChI | InChI=1S/C68H78O11/c1-7-10-11-12-13-14-19-42-76-63-39-36-58(54-32-30-53(31-33-54)57-25-24-49(4)64(47-57)73-6)48-65(63)79-68(72)60-46-56(35-38-62(60)75-41-21-16-18-23-44-78-67(71)9-3)52-28-26-51(27-29-52)55-34-37-61(59(45-55)50(5)69)74-40-20-15-17-22-43-77-66(70)8-2/h8-9,24-39,45-48H,2-3,7,10-23,40-44H2,1,4-6H3 |
| InChIKey | XERKSNNKMIYBQS-UHFFFAOYSA-N |
| XLogP | 16.56 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.36 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|