C28H38O6 — CID 138636641
6-[4-[3-methoxy-4-[2-(2-methylpropoxy)ethoxy]phenyl]phenoxy]hexyl prop-2-enoate (PubChem CID 138636641) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is 6-[4-[3-methoxy-4-[2-(2-methylpropoxy)ethoxy]phenyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[3-methoxy-4-[2-(2-methylpropoxy)ethoxy]phenyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 138636641 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 6-[4-[3-methoxy-4-[2-(2-methylpropoxy)ethoxy]phenyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(OCCOCC(C)C)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H38O6/c1-5-28(29)34-17-9-7-6-8-16-32-25-13-10-23(11-14-25)24-12-15-26(27(20-24)30-4)33-19-18-31-21-22(2)3/h5,10-15,20,22H,1,6-9,16-19,21H2,2-4H3 |
| InChIKey | BJNCJVAXRLORIB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|