C32H44O6 — CID 142301477
6-[4-[7-(2-methoxy-4-methylphenoxy)-3,6-dimethylhept-1-en-2-yl]oxyphenoxy]hexyl prop-2-enoate (PubChem CID 142301477) has the molecular formula C32H44O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is 6-[4-[7-(2-methoxy-4-methylphenoxy)-3,6-dimethylhept-1-en-2-yl]oxyphenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[7-(2-methoxy-4-methylphenoxy)-3,6-dimethylhept-1-en-2-yl]oxyphenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 142301477 |
| Molecular Formula | C32H44O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | 6-[4-[7-(2-methoxy-4-methylphenoxy)-3,6-dimethylhept-1-en-2-yl]oxyphenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=C)C(C)CCC(C)COc2ccc(C)cc2OC)cc1 |
| InChI | InChI=1S/C32H44O6/c1-7-32(33)36-21-11-9-8-10-20-35-28-15-17-29(18-16-28)38-27(5)26(4)14-12-25(3)23-37-30-19-13-24(2)22-31(30)34-6/h7,13,15-19,22,25-26H,1,5,8-12,14,20-21,23H2,2-4,6H3 |
| InChIKey | OMIDLFJDRVMRIJ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|