C38H38BrF2NO4 — CID 134170063
6-[4-[[4-[4-(2-bromo-4-propylphenyl)-2-methanimidoylphenyl]phenoxy]-difluoromethyl]phenoxy]hexyl prop-2-enoate (PubChem CID 134170063) has the molecular formula C38H38BrF2NO4 and a molecular weight of 690.63 g/mol. Its IUPAC name is 6-[4-[[4-[4-(2-bromo-4-propylphenyl)-2-methanimidoylphenyl]phenoxy]-difluoromethyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[[4-[4-(2-bromo-4-propylphenyl)-2-methanimidoylphenyl]phenoxy]-difluoromethyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 134170063 |
| Molecular Formula | C38H38BrF2NO4 |
| Molecular Weight | 690.63 g/mol |
| Exact Mass | 689.20 |
| IUPAC Name | 6-[4-[[4-[4-(2-bromo-4-propylphenyl)-2-methanimidoylphenyl]phenoxy]-difluoromethyl]phenoxy]hexyl prop-2-enoate |
| SMILES | [H]/N=C/c1cc(-c2ccc(CCC)cc2Br)ccc1-c1ccc(OC(F)(F)c2ccc(OCCCCCCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C38H38BrF2NO4/c1-3-9-27-10-20-35(36(39)24-27)29-13-21-34(30(25-29)26-42)28-11-16-33(17-12-28)46-38(40,41)31-14-18-32(19-15-31)44-22-7-5-6-8-23-45-37(43)4-2/h4,10-21,24-26,42H,2-3,5-9,22-23H2,1H3/b42-26+ |
| InChIKey | JTFWMIRYCLGWDH-OOWNWPBNSA-N |
| XLogP | 10.53 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.63 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|