C55H55BrFNO4 — CID 145123363
6-[4-[[4-[4-(2-bromo-4-propylphenyl)-2-ethenylphenyl]phenoxy]-fluoromethyl]phenoxy]hexyl prop-2-enoate;1-(9H-fluoren-2-yl)-N-methylethanimine (PubChem CID 145123363) has the molecular formula C55H55BrFNO4 and a molecular weight of 892.95 g/mol. Its IUPAC name is 6-[4-[[4-[4-(2-bromo-4-propylphenyl)-2-ethenylphenyl]phenoxy]-fluoromethyl]phenoxy]hexyl prop-2-enoate;1-(9H-fluoren-2-yl)-N-methylethanimine.
| Compound Name | 6-[4-[[4-[4-(2-bromo-4-propylphenyl)-2-ethenylphenyl]phenoxy]-fluoromethyl]phenoxy]hexyl prop-2-enoate;1-(9H-fluoren-2-yl)-N-methylethanimine |
|---|---|
| PubChem CID | 145123363 |
| Molecular Formula | C55H55BrFNO4 |
| Molecular Weight | 892.95 g/mol |
| Exact Mass | 891.33 |
| IUPAC Name | 6-[4-[[4-[4-(2-bromo-4-propylphenyl)-2-ethenylphenyl]phenoxy]-fluoromethyl]phenoxy]hexyl prop-2-enoate;1-(9H-fluoren-2-yl)-N-methylethanimine |
| SMILES | C/N=C(\C)c1ccc2c(c1)Cc1ccccc1-2.C=CC(=O)OCCCCCCOc1ccc(C(F)Oc2ccc(-c3ccc(-c4ccc(CCC)cc4Br)cc3C=C)cc2)cc1 |
| InChI | InChI=1S/C39H40BrFO4.C16H15N/c1-4-11-28-12-22-36(37(40)26-28)32-17-23-35(29(5-2)27-32)30-13-20-34(21-14-30)45-39(41)31-15-18-33(19-16-31)43-24-9-7-8-10-25-44-38(42)6-3;1-11(17-2)12-7-8-16-14(9-12)10-13-5-3-4-6-15(13)16/h5-6,12-23,26-27,39H,2-4,7-11,24-25H2,1H3;3-9H,10H2,1-2H3/b;17-11+ |
| InChIKey | FHTRYDIVDGWGPR-GNKLODFQSA-N |
| XLogP | 14.79 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.95 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|